C16H14Br2N2O2S2 — CID 118678248
(3aR,4S,9bS)-4-(2,5-dibromothiophen-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 118678248) has the molecular formula C16H14Br2N2O2S2 and a molecular weight of 490.24 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(2,5-dibromothiophen-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(2,5-dibromothiophen-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 118678248 |
| Molecular Formula | C16H14Br2N2O2S2 |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 487.89 |
| IUPAC Name | (3aR,4S,9bS)-4-(2,5-dibromothiophen-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1cc(Br)sc1Br)N2 |
| InChI | InChI=1S/C16H14Br2N2O2S2/c17-14-7-12(16(18)23-14)15-10-3-1-2-9(10)11-6-8(24(19,21)22)4-5-13(11)20-15/h1-2,4-7,9-10,15,20H,3H2,(H2,19,21,22)/t9-,10+,15-/m0/s1 |
| InChIKey | PIWFMQQSEBBXEY-WMFXKJRFSA-N |
| XLogP | 4.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|