C16H15BrN2O2S2 — CID 118683082
(3aR,4S,9bS)-4-(5-bromothiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 118683082) has the molecular formula C16H15BrN2O2S2 and a molecular weight of 411.35 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(5-bromothiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-4-(5-bromothiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 118683082 |
| Molecular Formula | C16H15BrN2O2S2 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | (3aR,4S,9bS)-4-(5-bromothiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(Br)s1)N2 |
| InChI | InChI=1S/C16H15BrN2O2S2/c17-15-7-6-14(22-15)16-11-3-1-2-10(11)12-8-9(23(18,20)21)4-5-13(12)19-16/h1-2,4-8,10-11,16,19H,3H2,(H2,18,20,21)/t10-,11+,16-/m0/s1 |
| InChIKey | XVYWBNQPHHLZSG-USBNGQNGSA-N |
| XLogP | 3.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|