C20H18N2O2S2 — CID 118678330
4-(1-benzothiophen-7-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 118678330) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(1-benzothiophen-7-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(1-benzothiophen-7-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 118678330 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-(1-benzothiophen-7-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1cccc3ccsc13)N2 |
| InChI | InChI=1S/C20H18N2O2S2/c21-26(23,24)13-7-8-18-17(11-13)14-4-2-5-15(14)19(22-18)16-6-1-3-12-9-10-25-20(12)16/h1-4,6-11,14-15,19,22H,5H2,(H2,21,23,24) |
| InChIKey | DRJVPEUDHFDKJF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|