C18H16Cl2N2O2S — CID 17242992
4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17242992) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17242992 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1c(Cl)cccc1Cl)N2 |
| InChI | InChI=1S/C18H16Cl2N2O2S/c19-14-5-2-6-15(20)17(14)18-12-4-1-3-11(12)13-9-10(25(21,23)24)7-8-16(13)22-18/h1-3,5-9,11-12,18,22H,4H2,(H2,21,23,24) |
| InChIKey | ZHEVBWZFJGIIPM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|