C26H22Cl2N2O2S — CID 17243014
4-(2,6-dichlorophenyl)-8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243014) has the molecular formula C26H22Cl2N2O2S and a molecular weight of 497.45 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,6-dichlorophenyl)-8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243014 |
| Molecular Formula | C26H22Cl2N2O2S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1c(Cl)cccc1Cl)N2)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H22Cl2N2O2S/c27-21-8-4-9-22(28)25(21)26-19-7-3-6-18(19)20-15-17(11-12-23(20)29-26)33(31,32)30-14-13-16-5-1-2-10-24(16)30/h1-6,8-12,15,18-19,26,29H,7,13-14H2 |
| InChIKey | GZMBAOYLSQLINT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|