C27H26N2O4S — CID 17238401
2-[8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-6-methoxyphenol (PubChem CID 17238401) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-6-methoxyphenol.
| Compound Name | 2-[8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 17238401 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[8-(2,3-dihydroindol-1-ylsulfonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-6-methoxyphenol |
| SMILES | COc1cccc(C2Nc3ccc(S(=O)(=O)N4CCc5ccccc54)cc3C3C=CCC32)c1O |
| InChI | InChI=1S/C27H26N2O4S/c1-33-25-11-5-9-21(27(25)30)26-20-8-4-7-19(20)22-16-18(12-13-23(22)28-26)34(31,32)29-15-14-17-6-2-3-10-24(17)29/h2-7,9-13,16,19-20,26,28,30H,8,14-15H2,1H3 |
| InChIKey | BTXSYNVSALDCOG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|