C27H34N2O5S — CID 17236909
8-(4-methylpiperidin-1-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17236909) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 8-(4-methylpiperidin-1-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(4-methylpiperidin-1-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17236909 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 8-(4-methylpiperidin-1-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc(C2Nc3ccc(S(=O)(=O)N4CCC(C)CC4)cc3C3C=CCC32)cc(OC)c1OC |
| InChI | InChI=1S/C27H34N2O5S/c1-17-10-12-29(13-11-17)35(30,31)19-8-9-23-22(16-19)20-6-5-7-21(20)26(28-23)18-14-24(32-2)27(34-4)25(15-18)33-3/h5-6,8-9,14-17,20-21,26,28H,7,10-13H2,1-4H3 |
| InChIKey | AVNVTXZNIUSYAN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|