C25H30N2O3S — CID 51419260
4-[4-[(3aR,4R,9bR)-8-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine (PubChem CID 51419260) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 4-[4-[(3aR,4R,9bR)-8-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(3aR,4R,9bR)-8-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 51419260 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-[4-[(3aR,4R,9bR)-8-propan-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine |
| SMILES | CC(C)c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccc(S(=O)(=O)N3CCOCC3)cc1)N2 |
| InChI | InChI=1S/C25H30N2O3S/c1-17(2)19-8-11-24-23(16-19)21-4-3-5-22(21)25(26-24)18-6-9-20(10-7-18)31(28,29)27-12-14-30-15-13-27/h3-4,6-11,16-17,21-22,25-26H,5,12-15H2,1-2H3/t21-,22-,25+/m1/s1 |
| InChIKey | GGZBFXYPTZUXKO-RQTOMXEWSA-N |
| XLogP | 4.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|