C22H22Cl2N2O4S — CID 17239667
2,4-dichloro-6-(8-morpholin-4-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol (PubChem CID 17239667) has the molecular formula C22H22Cl2N2O4S and a molecular weight of 481.40 g/mol. Its IUPAC name is 2,4-dichloro-6-(8-morpholin-4-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol.
| Compound Name | 2,4-dichloro-6-(8-morpholin-4-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
|---|---|
| PubChem CID | 17239667 |
| Molecular Formula | C22H22Cl2N2O4S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2,4-dichloro-6-(8-morpholin-4-ylsulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1cc(Cl)cc(Cl)c1O)N2)N1CCOCC1 |
| InChI | InChI=1S/C22H22Cl2N2O4S/c23-13-10-18(22(27)19(24)11-13)21-16-3-1-2-15(16)17-12-14(4-5-20(17)25-21)31(28,29)26-6-8-30-9-7-26/h1-2,4-5,10-12,15-16,21,25,27H,3,6-9H2 |
| InChIKey | HEOYLKXJQFXWOF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|