C22H24Cl2N2O — CID 17239625
2,4-dichloro-6-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol (PubChem CID 17239625) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is 2,4-dichloro-6-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol.
| Compound Name | 2,4-dichloro-6-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol |
|---|---|
| PubChem CID | 17239625 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2,4-dichloro-6-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol |
| SMILES | CCN(CC)c1ccc2c(c1)C1C=CCC1C(c1cc(Cl)cc(Cl)c1O)N2 |
| InChI | InChI=1S/C22H24Cl2N2O/c1-3-26(4-2)14-8-9-20-17(12-14)15-6-5-7-16(15)21(25-20)18-10-13(23)11-19(24)22(18)27/h5-6,8-12,15-16,21,25,27H,3-4,7H2,1-2H3 |
| InChIKey | SAEGMNSIGXCYQW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|