C25H26Cl2N2O2 — CID 17239754
[4-(3,5-dichloro-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 17239754) has the molecular formula C25H26Cl2N2O2 and a molecular weight of 457.40 g/mol. Its IUPAC name is [4-(3,5-dichloro-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [4-(3,5-dichloro-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17239754 |
| Molecular Formula | C25H26Cl2N2O2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [4-(3,5-dichloro-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)C2C=CCC2C(c2cc(Cl)cc(Cl)c2O)N3)CC1 |
| InChI | InChI=1S/C25H26Cl2N2O2/c1-14-7-9-29(10-8-14)25(31)15-5-6-22-19(11-15)17-3-2-4-18(17)23(28-22)20-12-16(26)13-21(27)24(20)30/h2-3,5-6,11-14,17-18,23,28,30H,4,7-10H2,1H3 |
| InChIKey | GVGWODVVJXQFLZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|