C23H23BrN2O — CID 29114389
[(3aR,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-pyrrolidin-1-ylmethanone (PubChem CID 29114389) has the molecular formula C23H23BrN2O and a molecular weight of 423.35 g/mol. Its IUPAC name is [(3aR,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aR,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 29114389 |
| Molecular Formula | C23H23BrN2O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [(3aR,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccc(Br)cc1)N2)N1CCCC1 |
| InChI | InChI=1S/C23H23BrN2O/c24-17-9-6-15(7-10-17)22-19-5-3-4-18(19)20-14-16(8-11-21(20)25-22)23(27)26-12-1-2-13-26/h3-4,6-11,14,18-19,22,25H,1-2,5,12-13H2/t18-,19-,22+/m1/s1 |
| InChIKey | MTWZOMYMUFGQCP-KNKQGSTJSA-N |
| XLogP | 5.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|