C29H37N3O — CID 17238996
azepan-1-yl-[4-[4-(diethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone (PubChem CID 17238996) has the molecular formula C29H37N3O and a molecular weight of 443.64 g/mol. Its IUPAC name is azepan-1-yl-[4-[4-(diethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone.
| Compound Name | azepan-1-yl-[4-[4-(diethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
|---|---|
| PubChem CID | 17238996 |
| Molecular Formula | C29H37N3O |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | azepan-1-yl-[4-[4-(diethylamino)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
| SMILES | CCN(CC)c1ccc(C2Nc3ccc(C(=O)N4CCCCCC4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C29H37N3O/c1-3-31(4-2)23-15-12-21(13-16-23)28-25-11-9-10-24(25)26-20-22(14-17-27(26)30-28)29(33)32-18-7-5-6-8-19-32/h9-10,12-17,20,24-25,28,30H,3-8,11,18-19H2,1-2H3 |
| InChIKey | BQSBMDBCACSAQB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|