C26H30N2O — CID 17238011
pyrrolidin-1-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone (PubChem CID 17238011) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is pyrrolidin-1-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
|---|---|
| PubChem CID | 17238011 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | pyrrolidin-1-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
| SMILES | Cc1cc(C)c(C2Nc3ccc(C(=O)N4CCCC4)cc3C3C=CCC32)c(C)c1 |
| InChI | InChI=1S/C26H30N2O/c1-16-13-17(2)24(18(3)14-16)25-21-8-6-7-20(21)22-15-19(9-10-23(22)27-25)26(29)28-11-4-5-12-28/h6-7,9-10,13-15,20-21,25,27H,4-5,8,11-12H2,1-3H3 |
| InChIKey | SYMCFWPKPYTSAL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|