C26H30N2O2 — CID 17238008
morpholin-4-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone (PubChem CID 17238008) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is morpholin-4-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone.
| Compound Name | morpholin-4-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
|---|---|
| PubChem CID | 17238008 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | morpholin-4-yl-[4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]methanone |
| SMILES | Cc1cc(C)c(C2Nc3ccc(C(=O)N4CCOCC4)cc3C3C=CCC32)c(C)c1 |
| InChI | InChI=1S/C26H30N2O2/c1-16-13-17(2)24(18(3)14-16)25-21-6-4-5-20(21)22-15-19(7-8-23(22)27-25)26(29)28-9-11-30-12-10-28/h4-5,7-8,13-15,20-21,25,27H,6,9-12H2,1-3H3 |
| InChIKey | FFWWHSZBGPKIEM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|