C23H24N2O2 — CID 7188062
[(3aR,4S,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-morpholin-4-ylmethanone (PubChem CID 7188062) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(3aR,4S,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,4S,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 7188062 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(3aR,4S,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@@H](c1ccccc1)N2)N1CCOCC1 |
| InChI | InChI=1S/C23H24N2O2/c26-23(25-11-13-27-14-12-25)17-9-10-21-20(15-17)18-7-4-8-19(18)22(24-21)16-5-2-1-3-6-16/h1-7,9-10,15,18-19,22,24H,8,11-14H2/t18-,19-,22-/m1/s1 |
| InChIKey | QYWQUZCAYKXECV-WOIUINJBSA-N |
| XLogP | 3.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|