C25H26Cl2N2O — CID 124718521
[(3aR,4R,9bR)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-[(2R)-2-methylpiperidin-1-yl]methanone (PubChem CID 124718521) has the molecular formula C25H26Cl2N2O and a molecular weight of 441.40 g/mol. Its IUPAC name is [(3aR,4R,9bR)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-[(2R)-2-methylpiperidin-1-yl]methanone.
| Compound Name | [(3aR,4R,9bR)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-[(2R)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124718521 |
| Molecular Formula | C25H26Cl2N2O |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(3aR,4R,9bR)-4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-[(2R)-2-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCCN1C(=O)c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C25H26Cl2N2O/c1-15-5-2-3-12-29(15)25(30)16-8-11-23-21(13-16)18-6-4-7-19(18)24(28-23)20-10-9-17(26)14-22(20)27/h4,6,8-11,13-15,18-19,24,28H,2-3,5,7,12H2,1H3/t15-,18-,19-,24-/m1/s1 |
| InChIKey | CRBAGAYXTWLVSR-WCGJNUNOSA-N |
| XLogP | 6.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|