C25H28Cl2N2O — CID 17241503
4-(2,4-dichlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17241503) has the molecular formula C25H28Cl2N2O and a molecular weight of 443.42 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17241503 |
| Molecular Formula | C25H28Cl2N2O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C25H28Cl2N2O/c1-3-12-29(13-4-2)25(30)16-8-11-23-21(14-16)18-6-5-7-19(18)24(28-23)20-10-9-17(26)15-22(20)27/h5-6,8-11,14-15,18-19,24,28H,3-4,7,12-13H2,1-2H3 |
| InChIKey | VNLPFYDLAOZYHO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|