C22H21Cl2NO2 — CID 17241407
propyl 4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 17241407) has the molecular formula C22H21Cl2NO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is propyl 4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | propyl 4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 17241407 |
| Molecular Formula | C22H21Cl2NO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | propyl 4-(2,4-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | CCCOC(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C22H21Cl2NO2/c1-2-10-27-22(26)13-6-9-20-18(11-13)15-4-3-5-16(15)21(25-20)17-8-7-14(23)12-19(17)24/h3-4,6-9,11-12,15-16,21,25H,2,5,10H2,1H3 |
| InChIKey | PYZXIKCOFPJYMR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|