C22H22Cl2N2O — CID 17241512
4-(2,4-dichlorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17241512) has the molecular formula C22H22Cl2N2O and a molecular weight of 401.34 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17241512 |
| Molecular Formula | C22H22Cl2N2O |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CCCNC(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C22H22Cl2N2O/c1-2-10-25-22(27)13-6-9-20-18(11-13)15-4-3-5-16(15)21(26-20)17-8-7-14(23)12-19(17)24/h3-4,6-9,11-12,15-16,21,26H,2,5,10H2,1H3,(H,25,27) |
| InChIKey | OKCBUJZRRGWHHS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|