C21H21ClN2O2 — CID 126386991
(3aR,4R,9bR)-4-(4-chlorophenyl)-N-(2-hydroxyethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 126386991) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is (3aR,4R,9bR)-4-(4-chlorophenyl)-N-(2-hydroxyethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | (3aR,4R,9bR)-4-(4-chlorophenyl)-N-(2-hydroxyethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 126386991 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (3aR,4R,9bR)-4-(4-chlorophenyl)-N-(2-hydroxyethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | O=C(NCCO)c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C21H21ClN2O2/c22-15-7-4-13(5-8-15)20-17-3-1-2-16(17)18-12-14(6-9-19(18)24-20)21(26)23-10-11-25/h1-2,4-9,12,16-17,20,24-25H,3,10-11H2,(H,23,26)/t16-,17-,20+/m1/s1 |
| InChIKey | MBFCHUDOZZUHQA-HLIPFELVSA-N |
| XLogP | 3.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|