C23H26N2O2S — CID 17244476
N-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17244476) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17244476 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(SC)cc1)N2 |
| InChI | InChI=1S/C23H26N2O2S/c1-27-13-12-24-23(26)16-8-11-21-20(14-16)18-4-3-5-19(18)22(25-21)15-6-9-17(28-2)10-7-15/h3-4,6-11,14,18-19,22,25H,5,12-13H2,1-2H3,(H,24,26) |
| InChIKey | NUOYHHCJAIDNGU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|