C26H23ClN2O2 — CID 7087561
(3aR,4R,9bS)-4-(4-chlorophenyl)-N-(4-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 7087561) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is (3aR,4R,9bS)-4-(4-chlorophenyl)-N-(4-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | (3aR,4R,9bS)-4-(4-chlorophenyl)-N-(4-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 7087561 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (3aR,4R,9bS)-4-(4-chlorophenyl)-N-(4-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@H](c2ccc(Cl)cc2)N3)cc1 |
| InChI | InChI=1S/C26H23ClN2O2/c1-31-20-12-10-19(11-13-20)28-26(30)17-7-14-24-23(15-17)21-3-2-4-22(21)25(29-24)16-5-8-18(27)9-6-16/h2-3,5-15,21-22,25,29H,4H2,1H3,(H,28,30)/t21-,22+,25-/m0/s1 |
| InChIKey | VSNYNWKZXCVVPL-FBLLAGFSSA-N |
| XLogP | 6.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|