C25H29ClN2O — CID 17238655
4-(3-chlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17238655) has the molecular formula C25H29ClN2O and a molecular weight of 408.97 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17238655 |
| Molecular Formula | C25H29ClN2O |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-(3-chlorophenyl)-N,N-dipropyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C25H29ClN2O/c1-3-13-28(14-4-2)25(29)18-11-12-23-22(16-18)20-9-6-10-21(20)24(27-23)17-7-5-8-19(26)15-17/h5-9,11-12,15-16,20-21,24,27H,3-4,10,13-14H2,1-2H3 |
| InChIKey | FVIZUQMJBXIGFP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|