C19H17Cl2NO2 — CID 17239638
2,4-dichloro-6-(8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol (PubChem CID 17239638) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2,4-dichloro-6-(8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol.
| Compound Name | 2,4-dichloro-6-(8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
|---|---|
| PubChem CID | 17239638 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2,4-dichloro-6-(8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
| SMILES | COc1ccc2c(c1)C1C=CCC1C(c1cc(Cl)cc(Cl)c1O)N2 |
| InChI | InChI=1S/C19H17Cl2NO2/c1-24-11-5-6-17-14(9-11)12-3-2-4-13(12)18(22-17)15-7-10(20)8-16(21)19(15)23/h2-3,5-9,12-13,18,22-23H,4H2,1H3 |
| InChIKey | PRNUAQFPCOUWRO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|