C18H14Cl2FNO — CID 17239631
2,4-dichloro-6-(8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol (PubChem CID 17239631) has the molecular formula C18H14Cl2FNO and a molecular weight of 350.22 g/mol. Its IUPAC name is 2,4-dichloro-6-(8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol.
| Compound Name | 2,4-dichloro-6-(8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
|---|---|
| PubChem CID | 17239631 |
| Molecular Formula | C18H14Cl2FNO |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2,4-dichloro-6-(8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1C1Nc2ccc(F)cc2C2C=CCC21 |
| InChI | InChI=1S/C18H14Cl2FNO/c19-9-6-14(18(23)15(20)7-9)17-12-3-1-2-11(12)13-8-10(21)4-5-16(13)22-17/h1-2,4-8,11-12,17,22-23H,3H2 |
| InChIKey | GARRIRFTPJZPQF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|