C18H14Cl2IN — CID 3751785
4-(2,4-dichlorophenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 3751785) has the molecular formula C18H14Cl2IN and a molecular weight of 442.13 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,4-dichlorophenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3751785 |
| Molecular Formula | C18H14Cl2IN |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 440.95 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1ccc(C2Nc3ccc(I)cc3C3C=CCC32)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2IN/c19-10-4-6-14(16(20)8-10)18-13-3-1-2-12(13)15-9-11(21)5-7-17(15)22-18/h1-2,4-9,12-13,18,22H,3H2 |
| InChIKey | MWPIHIXYMYKFQK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|