C20H20Cl2N2O2S — CID 17241426
4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17241426) has the molecular formula C20H20Cl2N2O2S and a molecular weight of 423.37 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17241426 |
| Molecular Formula | C20H20Cl2N2O2S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C20H20Cl2N2O2S/c1-24(2)27(25,26)13-7-9-19-17(11-13)14-4-3-5-15(14)20(23-19)16-8-6-12(21)10-18(16)22/h3-4,6-11,14-15,20,23H,5H2,1-2H3 |
| InChIKey | ITHICTYULOQTJV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|