C21H20Cl2N2O2S — CID 17241440
4-(2,4-dichlorophenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17241440) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17241440 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-2-10-24-28(26,27)14-7-9-20-18(12-14)15-4-3-5-16(15)21(25-20)17-8-6-13(22)11-19(17)23/h2-4,6-9,11-12,15-16,21,24-25H,1,5,10H2 |
| InChIKey | HTUGUMJAIGFAJZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|