C23H25ClN2O3S — CID 17239445
4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17239445) has the molecular formula C23H25ClN2O3S and a molecular weight of 444.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17239445 |
| Molecular Formula | C23H25ClN2O3S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C23H25ClN2O3S/c24-16-8-6-15(7-9-16)23-20-5-1-4-19(20)21-13-18(10-11-22(21)26-23)30(27,28)25-14-17-3-2-12-29-17/h1,4,6-11,13,17,19-20,23,25-26H,2-3,5,12,14H2 |
| InChIKey | LCJPYXXTZXYWQZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|