C24H30N2O2S — CID 17239094
4-(4-propan-2-ylphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17239094) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 4-(4-propan-2-ylphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-propan-2-ylphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17239094 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-(4-propan-2-ylphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(C(C)C)cc1)N2 |
| InChI | InChI=1S/C24H30N2O2S/c1-4-14-25-29(27,28)19-12-13-23-22(15-19)20-6-5-7-21(20)24(26-23)18-10-8-17(9-11-18)16(2)3/h5-6,8-13,15-16,20-21,24-26H,4,7,14H2,1-3H3 |
| InChIKey | YQDFOYVXWRIPGC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|