C25H30N2O — CID 17239154
2-methyl-N-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide (PubChem CID 17239154) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-methyl-N-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide.
| Compound Name | 2-methyl-N-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide |
|---|---|
| PubChem CID | 17239154 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-methyl-N-[4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C1C=CCC1C(c1ccc(C(C)C)cc1)N2 |
| InChI | InChI=1S/C25H30N2O/c1-15(2)17-8-10-18(11-9-17)24-21-7-5-6-20(21)22-14-19(12-13-23(22)27-24)26-25(28)16(3)4/h5-6,8-16,20-21,24,27H,7H2,1-4H3,(H,26,28) |
| InChIKey | GPUPKNBJPZFWCH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|