C23H25ClN2O — CID 17238652
N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide (PubChem CID 17238652) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide.
| Compound Name | N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 17238652 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C23H25ClN2O/c1-14(2)11-22(27)25-17-9-10-21-20(13-17)18-7-4-8-19(18)23(26-21)15-5-3-6-16(24)12-15/h3-7,9-10,12-14,18-19,23,26H,8,11H2,1-2H3,(H,25,27) |
| InChIKey | ICELWNKQWWCAEN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|