C20H18Cl2N2O — CID 6963432
N-[(3aR,4R,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]acetamide (PubChem CID 6963432) has the molecular formula C20H18Cl2N2O and a molecular weight of 373.28 g/mol. Its IUPAC name is N-[(3aR,4R,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]acetamide.
| Compound Name | N-[(3aR,4R,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]acetamide |
|---|---|
| PubChem CID | 6963432 |
| Molecular Formula | C20H18Cl2N2O |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[(3aR,4R,9bR)-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1cccc(Cl)c1Cl)N2 |
| InChI | InChI=1S/C20H18Cl2N2O/c1-11(25)23-12-8-9-18-16(10-12)13-4-2-5-14(13)20(24-18)15-6-3-7-17(21)19(15)22/h2-4,6-10,13-14,20,24H,5H2,1H3,(H,23,25)/t13-,14-,20-/m1/s1 |
| InChIKey | XULLAXYAWDWZNJ-ARGWCVDVSA-N |
| XLogP | 5.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|