C29H28Cl2N2O — CID 17243125
4-tert-butyl-N-[4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide (PubChem CID 17243125) has the molecular formula C29H28Cl2N2O and a molecular weight of 491.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 17243125 |
| Molecular Formula | C29H28Cl2N2O |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 4-tert-butyl-N-[4-(2,6-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc3c(c2)C2C=CCC2C(c2c(Cl)cccc2Cl)N3)cc1 |
| InChI | InChI=1S/C29H28Cl2N2O/c1-29(2,3)18-12-10-17(11-13-18)28(34)32-19-14-15-25-22(16-19)20-6-4-7-21(20)27(33-25)26-23(30)8-5-9-24(26)31/h4-6,8-16,20-21,27,33H,7H2,1-3H3,(H,32,34) |
| InChIKey | MFHRUHYJPDOYAL-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|