C26H24N2O — CID 17252662
3-methyl-N-(4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl)benzamide (PubChem CID 17252662) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-methyl-N-(4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl)benzamide.
| Compound Name | 3-methyl-N-(4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl)benzamide |
|---|---|
| PubChem CID | 17252662 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 3-methyl-N-(4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc3c(c2)C2C=CCC2C(c2ccccc2)N3)c1 |
| InChI | InChI=1S/C26H24N2O/c1-17-7-5-10-19(15-17)26(29)27-20-13-14-24-23(16-20)21-11-6-12-22(21)25(28-24)18-8-3-2-4-9-18/h2-11,13-16,21-22,25,28H,12H2,1H3,(H,27,29) |
| InChIKey | XHMWEQKBZPQEAF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|