C26H22FN3O3 — CID 2881905
4-(4-fluorophenyl)-N-(3-methyl-4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 2881905) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-methyl-4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-methyl-4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 2881905 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-methyl-4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3c(c2)C2C=CCC2C(c2ccc(F)cc2)N3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H22FN3O3/c1-15-13-19(10-12-24(15)30(32)33)28-26(31)17-7-11-23-22(14-17)20-3-2-4-21(20)25(29-23)16-5-8-18(27)9-6-16/h2-3,5-14,20-21,25,29H,4H2,1H3,(H,28,31) |
| InChIKey | NAULBUWJGXCSOS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|