C22H23FN2O — CID 17243891
N-[4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-methylpropanamide (PubChem CID 17243891) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-methylpropanamide.
| Compound Name | N-[4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 17243891 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C1C=CCC1C(c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C22H23FN2O/c1-13(2)22(26)24-16-10-11-20-19(12-16)17-4-3-5-18(17)21(25-20)14-6-8-15(23)9-7-14/h3-4,6-13,17-18,21,25H,5H2,1-2H3,(H,24,26) |
| InChIKey | VJJSQZONRRGHSV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|