C22H24FNO — CID 17243885
8-butan-2-yloxy-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243885) has the molecular formula C22H24FNO and a molecular weight of 337.44 g/mol. Its IUPAC name is 8-butan-2-yloxy-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-butan-2-yloxy-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243885 |
| Molecular Formula | C22H24FNO |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 8-butan-2-yloxy-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCC(C)Oc1ccc2c(c1)C1C=CCC1C(c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C22H24FNO/c1-3-14(2)25-17-11-12-21-20(13-17)18-5-4-6-19(18)22(24-21)15-7-9-16(23)10-8-15/h4-5,7-14,18-19,22,24H,3,6H2,1-2H3 |
| InChIKey | LQOQYRDAYSTQEL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|