C20H20BrNO — CID 124678056
(3aS,4R,9bR)-8-bromo-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 124678056) has the molecular formula C20H20BrNO and a molecular weight of 370.29 g/mol. Its IUPAC name is (3aS,4R,9bR)-8-bromo-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-8-bromo-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 124678056 |
| Molecular Formula | C20H20BrNO |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (3aS,4R,9bR)-8-bromo-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCOc1ccc([C@@H]2Nc3ccc(Br)cc3[C@@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H20BrNO/c1-2-23-15-9-6-13(7-10-15)20-17-5-3-4-16(17)18-12-14(21)8-11-19(18)22-20/h3-4,6-12,16-17,20,22H,2,5H2,1H3/t16-,17+,20+/m1/s1 |
| InChIKey | PUFZSGPDRHCWDK-UWVAXJGDSA-N |
| XLogP | 5.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|