C23H26BrNO — CID 17236644
4-(4-bromophenyl)-8-(3-methylbutoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17236644) has the molecular formula C23H26BrNO and a molecular weight of 412.37 g/mol. Its IUPAC name is 4-(4-bromophenyl)-8-(3-methylbutoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(4-bromophenyl)-8-(3-methylbutoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17236644 |
| Molecular Formula | C23H26BrNO |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-(4-bromophenyl)-8-(3-methylbutoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CC(C)CCOc1ccc2c(c1)C1C=CCC1C(c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C23H26BrNO/c1-15(2)12-13-26-18-10-11-22-21(14-18)19-4-3-5-20(19)23(25-22)16-6-8-17(24)9-7-16/h3-4,6-11,14-15,19-20,23,25H,5,12-13H2,1-2H3 |
| InChIKey | NGMCIMBNEOGSOY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|