C19H20BrNO2 — CID 50813456
(3aS,9bS)-8-bromo-4-(4-ethoxyphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 50813456) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is (3aS,9bS)-8-bromo-4-(4-ethoxyphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,9bS)-8-bromo-4-(4-ethoxyphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 50813456 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (3aS,9bS)-8-bromo-4-(4-ethoxyphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CCOc1ccc(C2Nc3ccc(Br)cc3[C@H]3OCC[C@@H]23)cc1 |
| InChI | InChI=1S/C19H20BrNO2/c1-2-22-14-6-3-12(4-7-14)18-15-9-10-23-19(15)16-11-13(20)5-8-17(16)21-18/h3-8,11,15,18-19,21H,2,9-10H2,1H3/t15-,18?,19-/m0/s1 |
| InChIKey | NKONFCVFXJUOQI-GZMMRYBBSA-N |
| XLogP | 5.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |