C19H20BrNO — CID 26367934
(3aS,4R,9bS)-4-(4-bromophenyl)-8-ethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 26367934) has the molecular formula C19H20BrNO and a molecular weight of 358.28 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-(4-bromophenyl)-8-ethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4R,9bS)-4-(4-bromophenyl)-8-ethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 26367934 |
| Molecular Formula | C19H20BrNO |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (3aS,4R,9bS)-4-(4-bromophenyl)-8-ethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CCc1ccc2c(c1)[C@H]1OCC[C@H]1[C@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C19H20BrNO/c1-2-12-3-8-17-16(11-12)19-15(9-10-22-19)18(21-17)13-4-6-14(20)7-5-13/h3-8,11,15,18-19,21H,2,9-10H2,1H3/t15-,18-,19-/m0/s1 |
| InChIKey | RYUAROWCFNFKPO-SNRMKQJTSA-N |
| XLogP | 5.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |