C17H17BrN2O3S — CID 118682880
(3aS,4S,9bS)-4-(4-bromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 118682880) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(4-bromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4S,9bS)-4-(4-bromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 118682880 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | (3aS,4S,9bS)-4-(4-bromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@H]1OCC[C@H]1[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C17H17BrN2O3S/c18-11-3-1-10(2-4-11)16-13-7-8-23-17(13)14-9-12(24(19,21)22)5-6-15(14)20-16/h1-6,9,13,16-17,20H,7-8H2,(H2,19,21,22)/t13-,16+,17-/m0/s1 |
| InChIKey | JPEQMKXLUWDZOE-XKQJLSEDSA-N |
| XLogP | 3.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |