C17H16BrNO2 — CID 26367837
3-[(3aS,4S,9bS)-8-bromo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol (PubChem CID 26367837) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-[(3aS,4S,9bS)-8-bromo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol.
| Compound Name | 3-[(3aS,4S,9bS)-8-bromo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol |
|---|---|
| PubChem CID | 26367837 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-[(3aS,4S,9bS)-8-bromo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol |
| SMILES | Oc1cccc([C@H]2Nc3ccc(Br)cc3[C@H]3OCC[C@@H]23)c1 |
| InChI | InChI=1S/C17H16BrNO2/c18-11-4-5-15-14(9-11)17-13(6-7-21-17)16(19-15)10-2-1-3-12(20)8-10/h1-5,8-9,13,16-17,19-20H,6-7H2/t13-,16+,17-/m0/s1 |
| InChIKey | OWTFKTJCXBCIOV-XKQJLSEDSA-N |
| XLogP | 4.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |