C18H18BrNO — CID 27262178
(3aS,4S,9bS)-4-(4-bromophenyl)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 27262178) has the molecular formula C18H18BrNO and a molecular weight of 344.25 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(4-bromophenyl)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4S,9bS)-4-(4-bromophenyl)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 27262178 |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (3aS,4S,9bS)-4-(4-bromophenyl)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | Cc1ccc2c(c1)[C@H]1OCC[C@H]1[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C18H18BrNO/c1-11-2-7-16-15(10-11)18-14(8-9-21-18)17(20-16)12-3-5-13(19)6-4-12/h2-7,10,14,17-18,20H,8-9H2,1H3/t14-,17+,18-/m0/s1 |
| InChIKey | CXVIDGGMNLBIKW-QGTPRVQTSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |