C22H27NO3 — CID 50813368
(4aS,10bS)-5-(3,4-dimethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 50813368) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (4aS,10bS)-5-(3,4-dimethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,10bS)-5-(3,4-dimethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 50813368 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (4aS,10bS)-5-(3,4-dimethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCc1ccc2c(c1)[C@H]1OCCC[C@H]1C(c1ccc(OC)c(OC)c1)N2 |
| InChI | InChI=1S/C22H27NO3/c1-4-14-7-9-18-17(12-14)22-16(6-5-11-26-22)21(23-18)15-8-10-19(24-2)20(13-15)25-3/h7-10,12-13,16,21-23H,4-6,11H2,1-3H3/t16-,21?,22-/m0/s1 |
| InChIKey | FNJNDBVNKGKYSV-URJRECBDSA-N |
| XLogP | 4.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |