C18H21NOS — CID 58956356
(4aR,5S,10bR)-9-ethyl-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956356) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is (4aR,5S,10bR)-9-ethyl-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aR,5S,10bR)-9-ethyl-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956356 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (4aR,5S,10bR)-9-ethyl-5-thiophen-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCc1ccc2c(c1)[C@@H]1OCCC[C@@H]1[C@@H](c1cccs1)N2 |
| InChI | InChI=1S/C18H21NOS/c1-2-12-7-8-15-14(11-12)18-13(5-3-9-20-18)17(19-15)16-6-4-10-21-16/h4,6-8,10-11,13,17-19H,2-3,5,9H2,1H3/t13-,17+,18-/m1/s1 |
| InChIKey | QFPVGGHYGWWELT-JEBQAFNWSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |