C23H29NO — CID 143070183
(5R)-9-(2-methylbutan-2-yl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 143070183) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (5R)-9-(2-methylbutan-2-yl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (5R)-9-(2-methylbutan-2-yl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 143070183 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (5R)-9-(2-methylbutan-2-yl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCC(C)(C)c1ccc2c(c1)C1OCCCC1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C23H29NO/c1-4-23(2,3)17-12-13-20-19(15-17)22-18(11-8-14-25-22)21(24-20)16-9-6-5-7-10-16/h5-7,9-10,12-13,15,18,21-22,24H,4,8,11,14H2,1-3H3/t18?,21-,22?/m0/s1 |
| InChIKey | DMMYLHUFFHBOMO-QUENFVSXSA-N |
| XLogP | 6.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |