C22H24F3NO — CID 58956783
9-tert-butyl-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956783) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is 9-tert-butyl-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 9-tert-butyl-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956783 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 9-tert-butyl-5-(2,4,5-trifluorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)C1OCCCC1C(c1cc(F)c(F)cc1F)N2 |
| InChI | InChI=1S/C22H24F3NO/c1-22(2,3)12-6-7-19-15(9-12)21-13(5-4-8-27-21)20(26-19)14-10-17(24)18(25)11-16(14)23/h6-7,9-11,13,20-21,26H,4-5,8H2,1-3H3 |
| InChIKey | PWVLKZYWTQCBFI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|